C27H42N6O2 — CID 123998715
1-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)oxybutyl]-3-(2,4,4-trimethylpentan-2-yl)urea (PubChem CID 123998715) has the molecular formula C27H42N6O2 and a molecular weight of 482.67 g/mol. Its IUPAC name is 1-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)oxybutyl]-3-(2,4,4-trimethylpentan-2-yl)urea.
| Compound Name | 1-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)oxybutyl]-3-(2,4,4-trimethylpentan-2-yl)urea |
|---|---|
| PubChem CID | 123998715 |
| Molecular Formula | C27H42N6O2 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | 1-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)oxybutyl]-3-(2,4,4-trimethylpentan-2-yl)urea |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1OCCCCNC(=O)NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C27H42N6O2/c1-7-8-15-21-31-22-23(19-13-9-10-14-20(19)30-24(22)28)33(21)35-17-12-11-16-29-25(34)32-27(5,6)18-26(2,3)4/h9-10,13-14H,7-8,11-12,15-18H2,1-6H3,(H2,28,30)(H2,29,32,34) |
| InChIKey | WKVXGDZUFDOQNQ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|