C23H33N5O2 — CID 130232255
N-[4-[2-butyl-4-(dimethylamino)imidazo[4,5-c]quinolin-1-yl]oxybutyl]propanamide (PubChem CID 130232255) has the molecular formula C23H33N5O2 and a molecular weight of 411.55 g/mol. Its IUPAC name is N-[4-[2-butyl-4-(dimethylamino)imidazo[4,5-c]quinolin-1-yl]oxybutyl]propanamide.
| Compound Name | N-[4-[2-butyl-4-(dimethylamino)imidazo[4,5-c]quinolin-1-yl]oxybutyl]propanamide |
|---|---|
| PubChem CID | 130232255 |
| Molecular Formula | C23H33N5O2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | N-[4-[2-butyl-4-(dimethylamino)imidazo[4,5-c]quinolin-1-yl]oxybutyl]propanamide |
| SMILES | CCCCc1nc2c(N(C)C)nc3ccccc3c2n1OCCCCNC(=O)CC |
| InChI | InChI=1S/C23H33N5O2/c1-5-7-14-19-26-21-22(28(19)30-16-11-10-15-24-20(29)6-2)17-12-8-9-13-18(17)25-23(21)27(3)4/h8-9,12-13H,5-7,10-11,14-16H2,1-4H3,(H,24,29) |
| InChIKey | JWNBBFOKEAEWPL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|