C30H43N5O3 — CID 154666644
benzyl N-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)oxybutyl]carbamate;ethane (PubChem CID 154666644) has the molecular formula C30H43N5O3 and a molecular weight of 521.71 g/mol. Its IUPAC name is benzyl N-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)oxybutyl]carbamate;ethane.
| Compound Name | benzyl N-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)oxybutyl]carbamate;ethane |
|---|---|
| PubChem CID | 154666644 |
| Molecular Formula | C30H43N5O3 |
| Molecular Weight | 521.71 g/mol |
| Exact Mass | 521.34 |
| IUPAC Name | benzyl N-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)oxybutyl]carbamate;ethane |
| SMILES | CC.CC.CCCCc1nc2c(N)nc3ccccc3c2n1OCCCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H31N5O3.2C2H6/c1-2-3-15-22-30-23-24(20-13-7-8-14-21(20)29-25(23)27)31(22)34-17-10-9-16-28-26(32)33-18-19-11-5-4-6-12-19;2*1-2/h4-8,11-14H,2-3,9-10,15-18H2,1H3,(H2,27,29)(H,28,32);2*1-2H3 |
| InChIKey | BRNRTCRIVYOMQV-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.71 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|