C22H34N5O2P — CID 175249454
1-(4-aminobutoxy)-2-butyl-7-diethylphosphanyloxyimidazo[4,5-c]quinolin-4-amine (PubChem CID 175249454) has the molecular formula C22H34N5O2P and a molecular weight of 431.52 g/mol. Its IUPAC name is 1-(4-aminobutoxy)-2-butyl-7-diethylphosphanyloxyimidazo[4,5-c]quinolin-4-amine.
| Compound Name | 1-(4-aminobutoxy)-2-butyl-7-diethylphosphanyloxyimidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 175249454 |
| Molecular Formula | C22H34N5O2P |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | 1-(4-aminobutoxy)-2-butyl-7-diethylphosphanyloxyimidazo[4,5-c]quinolin-4-amine |
| SMILES | CCCCc1nc2c(N)nc3cc(OP(CC)CC)ccc3c2n1OCCCCN |
| InChI | InChI=1S/C22H34N5O2P/c1-4-7-10-19-26-20-21(27(19)28-14-9-8-13-23)17-12-11-16(29-30(5-2)6-3)15-18(17)25-22(20)24/h11-12,15H,4-10,13-14,23H2,1-3H3,(H2,24,25) |
| InChIKey | VSEVUNSUBHQZSY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|