C20H29N5O — CID 58833712
7-(3-aminopropoxy)-1-(2-methylpropyl)-2-propylimidazo[4,5-c]quinolin-4-amine (PubChem CID 58833712) has the molecular formula C20H29N5O and a molecular weight of 355.49 g/mol. Its IUPAC name is 7-(3-aminopropoxy)-1-(2-methylpropyl)-2-propylimidazo[4,5-c]quinolin-4-amine.
| Compound Name | 7-(3-aminopropoxy)-1-(2-methylpropyl)-2-propylimidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 58833712 |
| Molecular Formula | C20H29N5O |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | 7-(3-aminopropoxy)-1-(2-methylpropyl)-2-propylimidazo[4,5-c]quinolin-4-amine |
| SMILES | CCCc1nc2c(N)nc3cc(OCCCN)ccc3c2n1CC(C)C |
| InChI | InChI=1S/C20H29N5O/c1-4-6-17-24-18-19(25(17)12-13(2)3)15-8-7-14(26-10-5-9-21)11-16(15)23-20(18)22/h7-8,11,13H,4-6,9-10,12,21H2,1-3H3,(H2,22,23) |
| InChIKey | BCIBQFLFQODTNU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|