C23H35N4O6P — CID 160668217
2-[4-amino-2-butyl-1-(2-hydroxyethyl)imidazo[4,5-c]quinolin-7-yl]oxyethyl [(2R)-2-methylbutyl] hydrogen phosphate (PubChem CID 160668217) has the molecular formula C23H35N4O6P and a molecular weight of 494.53 g/mol. Its IUPAC name is 2-[4-amino-2-butyl-1-(2-hydroxyethyl)imidazo[4,5-c]quinolin-7-yl]oxyethyl [(2R)-2-methylbutyl] hydrogen phosphate.
| Compound Name | 2-[4-amino-2-butyl-1-(2-hydroxyethyl)imidazo[4,5-c]quinolin-7-yl]oxyethyl [(2R)-2-methylbutyl] hydrogen phosphate |
|---|---|
| PubChem CID | 160668217 |
| Molecular Formula | C23H35N4O6P |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 2-[4-amino-2-butyl-1-(2-hydroxyethyl)imidazo[4,5-c]quinolin-7-yl]oxyethyl [(2R)-2-methylbutyl] hydrogen phosphate |
| SMILES | CCCCc1nc2c(N)nc3cc(OCCOP(=O)(O)OC[C@H](C)CC)ccc3c2n1CCO |
| InChI | InChI=1S/C23H35N4O6P/c1-4-6-7-20-26-21-22(27(20)10-11-28)18-9-8-17(14-19(18)25-23(21)24)31-12-13-32-34(29,30)33-15-16(3)5-2/h8-9,14,16,28H,4-7,10-13,15H2,1-3H3,(H2,24,25)(H,29,30)/t16-/m1/s1 |
| InChIKey | QXIADWOPTOKKBZ-MRXNPFEDSA-N |
| XLogP | 4.06 |
| TPSA | 141.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|