C23H34N5O8P — CID 134344117
3-[2-[4-amino-2-(butylamino)-1-(2-hydroxyethyl)imidazo[4,5-c]quinolin-7-yl]oxyethoxy-hydroxyphosphoryl]oxypropyl acetate (PubChem CID 134344117) has the molecular formula C23H34N5O8P and a molecular weight of 539.53 g/mol. Its IUPAC name is 3-[2-[4-amino-2-(butylamino)-1-(2-hydroxyethyl)imidazo[4,5-c]quinolin-7-yl]oxyethoxy-hydroxyphosphoryl]oxypropyl acetate.
| Compound Name | 3-[2-[4-amino-2-(butylamino)-1-(2-hydroxyethyl)imidazo[4,5-c]quinolin-7-yl]oxyethoxy-hydroxyphosphoryl]oxypropyl acetate |
|---|---|
| PubChem CID | 134344117 |
| Molecular Formula | C23H34N5O8P |
| Molecular Weight | 539.53 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | 3-[2-[4-amino-2-(butylamino)-1-(2-hydroxyethyl)imidazo[4,5-c]quinolin-7-yl]oxyethoxy-hydroxyphosphoryl]oxypropyl acetate |
| SMILES | CCCCNc1nc2c(N)nc3cc(OCCOP(=O)(O)OCCCOC(C)=O)ccc3c2n1CCO |
| InChI | InChI=1S/C23H34N5O8P/c1-3-4-8-25-23-27-20-21(28(23)9-10-29)18-7-6-17(15-19(18)26-22(20)24)34-13-14-36-37(31,32)35-12-5-11-33-16(2)30/h6-7,15,29H,3-5,8-14H2,1-2H3,(H2,24,26)(H,25,27)(H,31,32) |
| InChIKey | IYNMBQKQCFPKII-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 180.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.53 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|