C24H28N6O3 — CID 143012819
4-[4-amino-2-(2-hydroxyethyl)-7-phenylmethoxyimidazo[4,5-c]quinolin-1-yl]butylurea (PubChem CID 143012819) has the molecular formula C24H28N6O3 and a molecular weight of 448.53 g/mol. Its IUPAC name is 4-[4-amino-2-(2-hydroxyethyl)-7-phenylmethoxyimidazo[4,5-c]quinolin-1-yl]butylurea.
| Compound Name | 4-[4-amino-2-(2-hydroxyethyl)-7-phenylmethoxyimidazo[4,5-c]quinolin-1-yl]butylurea |
|---|---|
| PubChem CID | 143012819 |
| Molecular Formula | C24H28N6O3 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 4-[4-amino-2-(2-hydroxyethyl)-7-phenylmethoxyimidazo[4,5-c]quinolin-1-yl]butylurea |
| SMILES | NC(=O)NCCCCn1c(CCO)nc2c(N)nc3cc(OCc4ccccc4)ccc3c21 |
| InChI | InChI=1S/C24H28N6O3/c25-23-21-22(30(20(29-21)10-13-31)12-5-4-11-27-24(26)32)18-9-8-17(14-19(18)28-23)33-15-16-6-2-1-3-7-16/h1-3,6-9,14,31H,4-5,10-13,15H2,(H2,25,28)(H3,26,27,32) |
| InChIKey | XTMLMJLPUBNMGJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 141.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|