C30H32N6O2 — CID 68970171
1-[4-(4-amino-2-ethyl-8-phenylmethoxyimidazo[4,5-c]quinolin-1-yl)butyl]-1-phenylurea (PubChem CID 68970171) has the molecular formula C30H32N6O2 and a molecular weight of 508.63 g/mol. Its IUPAC name is 1-[4-(4-amino-2-ethyl-8-phenylmethoxyimidazo[4,5-c]quinolin-1-yl)butyl]-1-phenylurea.
| Compound Name | 1-[4-(4-amino-2-ethyl-8-phenylmethoxyimidazo[4,5-c]quinolin-1-yl)butyl]-1-phenylurea |
|---|---|
| PubChem CID | 68970171 |
| Molecular Formula | C30H32N6O2 |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 1-[4-(4-amino-2-ethyl-8-phenylmethoxyimidazo[4,5-c]quinolin-1-yl)butyl]-1-phenylurea |
| SMILES | CCc1nc2c(N)nc3ccc(OCc4ccccc4)cc3c2n1CCCCN(C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C30H32N6O2/c1-2-26-34-27-28(36(26)18-10-9-17-35(30(32)37)22-13-7-4-8-14-22)24-19-23(15-16-25(24)33-29(27)31)38-20-21-11-5-3-6-12-21/h3-8,11-16,19H,2,9-10,17-18,20H2,1H3,(H2,31,33)(H2,32,37) |
| InChIKey | VOXHJATUNSZDCK-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|