C29H47N5O4 — CID 143030078
tert-butyl N-[2-(4-amino-2-ethyl-1-propylimidazo[4,5-c]quinolin-7-yl)oxyethyl]carbamate;1-ethoxy-3-methylbutane (PubChem CID 143030078) has the molecular formula C29H47N5O4 and a molecular weight of 529.73 g/mol. Its IUPAC name is tert-butyl N-[2-(4-amino-2-ethyl-1-propylimidazo[4,5-c]quinolin-7-yl)oxyethyl]carbamate;1-ethoxy-3-methylbutane.
| Compound Name | tert-butyl N-[2-(4-amino-2-ethyl-1-propylimidazo[4,5-c]quinolin-7-yl)oxyethyl]carbamate;1-ethoxy-3-methylbutane |
|---|---|
| PubChem CID | 143030078 |
| Molecular Formula | C29H47N5O4 |
| Molecular Weight | 529.73 g/mol |
| Exact Mass | 529.36 |
| IUPAC Name | tert-butyl N-[2-(4-amino-2-ethyl-1-propylimidazo[4,5-c]quinolin-7-yl)oxyethyl]carbamate;1-ethoxy-3-methylbutane |
| SMILES | CCCn1c(CC)nc2c(N)nc3cc(OCCNC(=O)OC(C)(C)C)ccc3c21.CCOCCC(C)C |
| InChI | InChI=1S/C22H31N5O3.C7H16O/c1-6-11-27-17(7-2)26-18-19(27)15-9-8-14(13-16(15)25-20(18)23)29-12-10-24-21(28)30-22(3,4)5;1-4-8-6-5-7(2)3/h8-9,13H,6-7,10-12H2,1-5H3,(H2,23,25)(H,24,28);7H,4-6H2,1-3H3 |
| InChIKey | KCEWYJPLJSSTHM-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.73 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|