C24H34BrN5O3 — CID 165149760
tert-butyl N-[[4-amino-7-bromo-1-(2-butoxyethyl)imidazo[4,5-c]quinolin-2-yl]methyl]-N-ethylcarbamate (PubChem CID 165149760) has the molecular formula C24H34BrN5O3 and a molecular weight of 520.47 g/mol. Its IUPAC name is tert-butyl N-[[4-amino-7-bromo-1-(2-butoxyethyl)imidazo[4,5-c]quinolin-2-yl]methyl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[[4-amino-7-bromo-1-(2-butoxyethyl)imidazo[4,5-c]quinolin-2-yl]methyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 165149760 |
| Molecular Formula | C24H34BrN5O3 |
| Molecular Weight | 520.47 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | tert-butyl N-[[4-amino-7-bromo-1-(2-butoxyethyl)imidazo[4,5-c]quinolin-2-yl]methyl]-N-ethylcarbamate |
| SMILES | CCCCOCCn1c(CN(CC)C(=O)OC(C)(C)C)nc2c(N)nc3cc(Br)ccc3c21 |
| InChI | InChI=1S/C24H34BrN5O3/c1-6-8-12-32-13-11-30-19(15-29(7-2)23(31)33-24(3,4)5)28-20-21(30)17-10-9-16(25)14-18(17)27-22(20)26/h9-10,14H,6-8,11-13,15H2,1-5H3,(H2,26,27) |
| InChIKey | BOYQIRSAUVPNAK-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.47 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|