C24H28BrN5O2S — CID 167120624
tert-butyl N-[[7-amino-3-[[4-(bromomethyl)phenyl]methyl]-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-4-yl]methyl]-N-ethylcarbamate (PubChem CID 167120624) has the molecular formula C24H28BrN5O2S and a molecular weight of 530.49 g/mol. Its IUPAC name is tert-butyl N-[[7-amino-3-[[4-(bromomethyl)phenyl]methyl]-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-4-yl]methyl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[[7-amino-3-[[4-(bromomethyl)phenyl]methyl]-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-4-yl]methyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 167120624 |
| Molecular Formula | C24H28BrN5O2S |
| Molecular Weight | 530.49 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | tert-butyl N-[[7-amino-3-[[4-(bromomethyl)phenyl]methyl]-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-4-yl]methyl]-N-ethylcarbamate |
| SMILES | CCN(Cc1nc2c(N)nc3ccsc3c2n1Cc1ccc(CBr)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H28BrN5O2S/c1-5-29(23(31)32-24(2,3)4)14-18-28-19-20(21-17(10-11-33-21)27-22(19)26)30(18)13-16-8-6-15(12-25)7-9-16/h6-11H,5,12-14H2,1-4H3,(H2,26,27) |
| InChIKey | GHGWNNKLFOSBHR-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.49 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|