C15H21NO4 — CID 63788319
tert-butyl N-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamate (PubChem CID 63788319) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is tert-butyl N-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamate.
| Compound Name | tert-butyl N-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamate |
|---|---|
| PubChem CID | 63788319 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | tert-butyl N-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamate |
| SMILES | CCN(Cc1ccc2c(c1)OCO2)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H21NO4/c1-5-16(14(17)20-15(2,3)4)9-11-6-7-12-13(8-11)19-10-18-12/h6-8H,5,9-10H2,1-4H3 |
| InChIKey | OCZBRLHXVOYPOC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |