C21H20N2O6 — CID 67089425
tert-butyl N-(1,3-benzodioxol-5-ylmethyl)-N-(1,3-dioxoisoindol-2-yl)carbamate (PubChem CID 67089425) has the molecular formula C21H20N2O6 and a molecular weight of 396.40 g/mol. Its IUPAC name is tert-butyl N-(1,3-benzodioxol-5-ylmethyl)-N-(1,3-dioxoisoindol-2-yl)carbamate.
| Compound Name | tert-butyl N-(1,3-benzodioxol-5-ylmethyl)-N-(1,3-dioxoisoindol-2-yl)carbamate |
|---|---|
| PubChem CID | 67089425 |
| Molecular Formula | C21H20N2O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | tert-butyl N-(1,3-benzodioxol-5-ylmethyl)-N-(1,3-dioxoisoindol-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccc2c(c1)OCO2)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H20N2O6/c1-21(2,3)29-20(26)22(11-13-8-9-16-17(10-13)28-12-27-16)23-18(24)14-6-4-5-7-15(14)19(23)25/h4-10H,11-12H2,1-3H3 |
| InChIKey | XKKJDDQNEUBVKQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|