C20H18N2O5 — CID 17414825
N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-2-(1,3-dioxoisoindol-2-yl)-N-methylacetamide (PubChem CID 17414825) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-2-(1,3-dioxoisoindol-2-yl)-N-methylacetamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-2-(1,3-dioxoisoindol-2-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 17414825 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-2-(1,3-dioxoisoindol-2-yl)-N-methylacetamide |
| SMILES | CN(Cc1ccc2c(c1)OCCO2)C(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H18N2O5/c1-21(11-13-6-7-16-17(10-13)27-9-8-26-16)18(23)12-22-19(24)14-4-2-3-5-15(14)20(22)25/h2-7,10H,8-9,11-12H2,1H3 |
| InChIKey | RWOCXJGSBOADQK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|