C18H15FN2O3 — CID 26292160
2-(1,3-dioxoisoindol-2-yl)-N-[(3-fluorophenyl)methyl]-N-methylacetamide (PubChem CID 26292160) has the molecular formula C18H15FN2O3 and a molecular weight of 326.33 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[(3-fluorophenyl)methyl]-N-methylacetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[(3-fluorophenyl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 26292160 |
| Molecular Formula | C18H15FN2O3 |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[(3-fluorophenyl)methyl]-N-methylacetamide |
| SMILES | CN(Cc1cccc(F)c1)C(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H15FN2O3/c1-20(10-12-5-4-6-13(19)9-12)16(22)11-21-17(23)14-7-2-3-8-15(14)18(21)24/h2-9H,10-11H2,1H3 |
| InChIKey | MMBCJZRSCRQIAC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|