C20H20FN3O3 — CID 51867023
2-[(4S)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N-[(3-fluorophenyl)methyl]-N-methylacetamide (PubChem CID 51867023) has the molecular formula C20H20FN3O3 and a molecular weight of 369.40 g/mol. Its IUPAC name is 2-[(4S)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N-[(3-fluorophenyl)methyl]-N-methylacetamide.
| Compound Name | 2-[(4S)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N-[(3-fluorophenyl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 51867023 |
| Molecular Formula | C20H20FN3O3 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 2-[(4S)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N-[(3-fluorophenyl)methyl]-N-methylacetamide |
| SMILES | CN(Cc1cccc(F)c1)C(=O)CN1C(=O)N[C@@H](Cc2ccccc2)C1=O |
| InChI | InChI=1S/C20H20FN3O3/c1-23(12-15-8-5-9-16(21)10-15)18(25)13-24-19(26)17(22-20(24)27)11-14-6-3-2-4-7-14/h2-10,17H,11-13H2,1H3,(H,22,27)/t17-/m0/s1 |
| InChIKey | WISPXFGQKAUYTO-KRWDZBQOSA-N |
| XLogP | 1.95 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|