C20H20BrN3O3 — CID 42988064
2-(4-benzyl-2,5-dioxoimidazolidin-1-yl)-N-[(4-bromophenyl)methyl]-N-methylacetamide (PubChem CID 42988064) has the molecular formula C20H20BrN3O3 and a molecular weight of 430.30 g/mol. Its IUPAC name is 2-(4-benzyl-2,5-dioxoimidazolidin-1-yl)-N-[(4-bromophenyl)methyl]-N-methylacetamide.
| Compound Name | 2-(4-benzyl-2,5-dioxoimidazolidin-1-yl)-N-[(4-bromophenyl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 42988064 |
| Molecular Formula | C20H20BrN3O3 |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 2-(4-benzyl-2,5-dioxoimidazolidin-1-yl)-N-[(4-bromophenyl)methyl]-N-methylacetamide |
| SMILES | CN(Cc1ccc(Br)cc1)C(=O)CN1C(=O)NC(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C20H20BrN3O3/c1-23(12-15-7-9-16(21)10-8-15)18(25)13-24-19(26)17(22-20(24)27)11-14-5-3-2-4-6-14/h2-10,17H,11-13H2,1H3,(H,22,27) |
| InChIKey | ARRWPIYHDUVFNB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|