C22H24N2O4 — CID 18151884
2-[4-[1,3-benzodioxol-5-ylmethyl(ethyl)amino]butyl]isoindole-1,3-dione (PubChem CID 18151884) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 2-[4-[1,3-benzodioxol-5-ylmethyl(ethyl)amino]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[1,3-benzodioxol-5-ylmethyl(ethyl)amino]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 18151884 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 2-[4-[1,3-benzodioxol-5-ylmethyl(ethyl)amino]butyl]isoindole-1,3-dione |
| SMILES | CCN(CCCCN1C(=O)c2ccccc2C1=O)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H24N2O4/c1-2-23(14-16-9-10-19-20(13-16)28-15-27-19)11-5-6-12-24-21(25)17-7-3-4-8-18(17)22(24)26/h3-4,7-10,13H,2,5-6,11-12,14-15H2,1H3 |
| InChIKey | MIOOCRYFRSVIGI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|