C16H12N2O3 — CID 175547651
2-(1,3-benzodioxol-5-ylmethyl)-3-iminoisoindol-1-one (PubChem CID 175547651) has the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-3-iminoisoindol-1-one.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-3-iminoisoindol-1-one |
|---|---|
| PubChem CID | 175547651 |
| Molecular Formula | C16H12N2O3 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-3-iminoisoindol-1-one |
| SMILES | [H]/N=C1\c2ccccc2C(=O)N1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H12N2O3/c17-15-11-3-1-2-4-12(11)16(19)18(15)8-10-5-6-13-14(7-10)21-9-20-13/h1-7,17H,8-9H2/b17-15+ |
| InChIKey | SMFICAIVJIYJHJ-BMRADRMJSA-N |
| XLogP | 2.40 |
| TPSA | 62.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|