C22H23N3O4 — CID 7042190
2-(1,3-benzodioxol-5-ylmethyl)-4-[2-(dimethylamino)ethyliminomethyl]-4H-isoquinoline-1,3-dione (PubChem CID 7042190) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-4-[2-(dimethylamino)ethyliminomethyl]-4H-isoquinoline-1,3-dione.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-4-[2-(dimethylamino)ethyliminomethyl]-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 7042190 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-4-[2-(dimethylamino)ethyliminomethyl]-4H-isoquinoline-1,3-dione |
| SMILES | CN(C)CC/N=C/C1C(=O)N(Cc2ccc3c(c2)OCO3)C(=O)c2ccccc21 |
| InChI | InChI=1S/C22H23N3O4/c1-24(2)10-9-23-12-18-16-5-3-4-6-17(16)21(26)25(22(18)27)13-15-7-8-19-20(11-15)29-14-28-19/h3-8,11-12,18H,9-10,13-14H2,1-2H3/b23-12+ |
| InChIKey | GZRZHKXGIVDNBU-FSJBWODESA-N |
| XLogP | 2.31 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|