C25H26N2O4 — CID 7777470
2-(1,3-benzodioxol-5-ylmethyl)-4-[[(1R,2R)-2-methylcyclohexyl]iminomethyl]-4H-isoquinoline-1,3-dione (PubChem CID 7777470) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-4-[[(1R,2R)-2-methylcyclohexyl]iminomethyl]-4H-isoquinoline-1,3-dione.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-4-[[(1R,2R)-2-methylcyclohexyl]iminomethyl]-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 7777470 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-4-[[(1R,2R)-2-methylcyclohexyl]iminomethyl]-4H-isoquinoline-1,3-dione |
| SMILES | C[C@@H]1CCCC[C@H]1/N=C/C1C(=O)N(Cc2ccc3c(c2)OCO3)C(=O)c2ccccc21 |
| InChI | InChI=1S/C25H26N2O4/c1-16-6-2-5-9-21(16)26-13-20-18-7-3-4-8-19(18)24(28)27(25(20)29)14-17-10-11-22-23(12-17)31-15-30-22/h3-4,7-8,10-13,16,20-21H,2,5-6,9,14-15H2,1H3/b26-13+/t16-,20?,21-/m1/s1 |
| InChIKey | BPUMKAHNNJXMKU-ZHJFNYFPSA-N |
| XLogP | 4.33 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|