C20H13NO4 — CID 2853218
2-(1,3-benzodioxol-5-ylmethyl)benzo[de]isoquinoline-1,3-dione (PubChem CID 2853218) has the molecular formula C20H13NO4 and a molecular weight of 331.33 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 2853218 |
| Molecular Formula | C20H13NO4 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3cccc(c23)C(=O)N1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H13NO4/c22-19-14-5-1-3-13-4-2-6-15(18(13)14)20(23)21(19)10-12-7-8-16-17(9-12)25-11-24-16/h1-9H,10-11H2 |
| InChIKey | UZTNBKGRMIQKMR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|