C21H19BrN2O4 — CID 91906010
(3aR,6aS)-5-(1,3-benzodioxol-5-ylmethyl)-2-[(3-bromophenyl)methyl]-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione (PubChem CID 91906010) has the molecular formula C21H19BrN2O4 and a molecular weight of 443.30 g/mol. Its IUPAC name is (3aR,6aS)-5-(1,3-benzodioxol-5-ylmethyl)-2-[(3-bromophenyl)methyl]-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione.
| Compound Name | (3aR,6aS)-5-(1,3-benzodioxol-5-ylmethyl)-2-[(3-bromophenyl)methyl]-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 91906010 |
| Molecular Formula | C21H19BrN2O4 |
| Molecular Weight | 443.30 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | (3aR,6aS)-5-(1,3-benzodioxol-5-ylmethyl)-2-[(3-bromophenyl)methyl]-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione |
| SMILES | O=C1[C@H]2CN(Cc3cccc(Br)c3)C[C@H]2C(=O)N1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H19BrN2O4/c22-15-3-1-2-13(6-15)8-23-10-16-17(11-23)21(26)24(20(16)25)9-14-4-5-18-19(7-14)28-12-27-18/h1-7,16-17H,8-12H2/t16-,17+ |
| InChIKey | ZAVRYQJXVDFIHA-CALCHBBNSA-N |
| XLogP | 2.79 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|