C16H17BrNO2+ — CID 2053262
2-(1,3-benzodioxol-5-yl)ethyl-[(3-bromophenyl)methyl]azanium (PubChem CID 2053262) has the molecular formula C16H17BrNO2+ and a molecular weight of 335.22 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)ethyl-[(3-bromophenyl)methyl]azanium.
| Compound Name | 2-(1,3-benzodioxol-5-yl)ethyl-[(3-bromophenyl)methyl]azanium |
|---|---|
| PubChem CID | 2053262 |
| Molecular Formula | C16H17BrNO2+ |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)ethyl-[(3-bromophenyl)methyl]azanium |
| SMILES | Brc1cccc(C[NH2+]CCc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C16H16BrNO2/c17-14-3-1-2-13(8-14)10-18-7-6-12-4-5-15-16(9-12)20-11-19-15/h1-5,8-9,18H,6-7,10-11H2/p+1 |
| InChIKey | KFXVVVPGODJCSG-UHFFFAOYSA-O |
| XLogP | 2.48 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|