C17H18NO2+ — CID 7248452
1,3-benzodioxol-5-ylmethyl-[(E)-3-phenylprop-2-enyl]azanium (PubChem CID 7248452) has the molecular formula C17H18NO2+ and a molecular weight of 268.34 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl-[(E)-3-phenylprop-2-enyl]azanium.
| Compound Name | 1,3-benzodioxol-5-ylmethyl-[(E)-3-phenylprop-2-enyl]azanium |
|---|---|
| PubChem CID | 7248452 |
| Molecular Formula | C17H18NO2+ |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl-[(E)-3-phenylprop-2-enyl]azanium |
| SMILES | C(=C/c1ccccc1)\C[NH2+]Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H17NO2/c1-2-5-14(6-3-1)7-4-10-18-12-15-8-9-16-17(11-15)20-13-19-16/h1-9,11,18H,10,12-13H2/p+1/b7-4+ |
| InChIKey | XTUIUIDTYOEITB-QPJJXVBHSA-O |
| XLogP | 2.19 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|