C16H14O3 — CID 54275545
5-(3-phenylprop-2-enoxy)-1,3-benzodioxole (PubChem CID 54275545) has the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. Its IUPAC name is 5-(3-phenylprop-2-enoxy)-1,3-benzodioxole.
| Compound Name | 5-(3-phenylprop-2-enoxy)-1,3-benzodioxole |
|---|---|
| PubChem CID | 54275545 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 5-(3-phenylprop-2-enoxy)-1,3-benzodioxole |
| SMILES | C(=Cc1ccccc1)COc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H14O3/c1-2-5-13(6-3-1)7-4-10-17-14-8-9-15-16(11-14)19-12-18-15/h1-9,11H,10,12H2 |
| InChIKey | RNDVQQKZAUFCAK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |