C11H12O3 — CID 10511936
5-but-3-enoxy-1,3-benzodioxole (PubChem CID 10511936) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is 5-but-3-enoxy-1,3-benzodioxole.
| Compound Name | 5-but-3-enoxy-1,3-benzodioxole |
|---|---|
| PubChem CID | 10511936 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 5-but-3-enoxy-1,3-benzodioxole |
| SMILES | C=CCCOc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H12O3/c1-2-3-6-12-9-4-5-10-11(7-9)14-8-13-10/h2,4-5,7H,1,3,6,8H2 |
| InChIKey | LABNXTIQHDVUDJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|