C13H19NO5 — CID 82353580
2-[2-[2-(1,3-benzodioxol-5-yloxy)ethoxy]ethoxy]ethanamine (PubChem CID 82353580) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-[2-[2-(1,3-benzodioxol-5-yloxy)ethoxy]ethoxy]ethanamine.
| Compound Name | 2-[2-[2-(1,3-benzodioxol-5-yloxy)ethoxy]ethoxy]ethanamine |
|---|---|
| PubChem CID | 82353580 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-[2-[2-(1,3-benzodioxol-5-yloxy)ethoxy]ethoxy]ethanamine |
| SMILES | NCCOCCOCCOc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H19NO5/c14-3-4-15-5-6-16-7-8-17-11-1-2-12-13(9-11)19-10-18-12/h1-2,9H,3-8,10,14H2 |
| InChIKey | ARBIALUNVFBHIM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|