C15H15NO4 — CID 39372047
3-[2-(1,3-benzodioxol-5-yloxy)ethoxy]aniline (PubChem CID 39372047) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is 3-[2-(1,3-benzodioxol-5-yloxy)ethoxy]aniline.
| Compound Name | 3-[2-(1,3-benzodioxol-5-yloxy)ethoxy]aniline |
|---|---|
| PubChem CID | 39372047 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 3-[2-(1,3-benzodioxol-5-yloxy)ethoxy]aniline |
| SMILES | Nc1cccc(OCCOc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C15H15NO4/c16-11-2-1-3-12(8-11)17-6-7-18-13-4-5-14-15(9-13)20-10-19-14/h1-5,8-9H,6-7,10,16H2 |
| InChIKey | JPTGOQUSQNOQTC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|