C17H14O7 — CID 155681715
1,3-benzodioxol-5-yl 3-(1,3-benzodioxol-5-yloxy)propanoate (PubChem CID 155681715) has the molecular formula C17H14O7 and a molecular weight of 330.29 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 3-(1,3-benzodioxol-5-yloxy)propanoate.
| Compound Name | 1,3-benzodioxol-5-yl 3-(1,3-benzodioxol-5-yloxy)propanoate |
|---|---|
| PubChem CID | 155681715 |
| Molecular Formula | C17H14O7 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 1,3-benzodioxol-5-yl 3-(1,3-benzodioxol-5-yloxy)propanoate |
| SMILES | O=C(CCOc1ccc2c(c1)OCO2)Oc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H14O7/c18-17(24-12-2-4-14-16(8-12)23-10-21-14)5-6-19-11-1-3-13-15(7-11)22-9-20-13/h1-4,7-8H,5-6,9-10H2 |
| InChIKey | FNCPODTUDKGRDM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|