C9H9NO4 — CID 82112116
1,3-benzodioxol-5-yl 2-aminoacetate (PubChem CID 82112116) has the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 2-aminoacetate.
| Compound Name | 1,3-benzodioxol-5-yl 2-aminoacetate |
|---|---|
| PubChem CID | 82112116 |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 1,3-benzodioxol-5-yl 2-aminoacetate |
| SMILES | NCC(=O)Oc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H9NO4/c10-4-9(11)14-6-1-2-7-8(3-6)13-5-12-7/h1-3H,4-5,10H2 |
| InChIKey | KMUZJTYLLRPQLO-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|