C11H12O5 — CID 4507465
methyl 2-(1,3-benzodioxol-5-yloxy)propanoate (PubChem CID 4507465) has the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. Its IUPAC name is methyl 2-(1,3-benzodioxol-5-yloxy)propanoate.
| Compound Name | methyl 2-(1,3-benzodioxol-5-yloxy)propanoate |
|---|---|
| PubChem CID | 4507465 |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | methyl 2-(1,3-benzodioxol-5-yloxy)propanoate |
| SMILES | COC(=O)C(C)Oc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H12O5/c1-7(11(12)13-2)16-8-3-4-9-10(5-8)15-6-14-9/h3-5,7H,6H2,1-2H3 |
| InChIKey | OWWUVCPUNQXVEC-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |