methyl 2-(1,3-benzodioxol-5-yloxy)propanoate

C11H12O5 — CID 4507465

IUPACmethyl 2-(1,3-benzodioxol-5-yloxy)propanoate
SMILESCOC(=O)C(C)Oc1ccc2c(c1)OCO2
InChIInChI=1S/C11H12O5/c1-7(11(12)13-2)16-8-3-4-9-10(5-8)15-6-14-9/h3-5,7H,6H2,1-2H3
InChIKeyOWWUVCPUNQXVEC-UHFFFAOYSA-N
MW224.21 g/mol
LogP1.36
Rot. Bonds3

About methyl 2-(1,3-benzodioxol-5-yloxy)propanoate

methyl 2-(1,3-benzodioxol-5-yloxy)propanoate (PubChem CID 4507465) has the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. Its IUPAC name is methyl 2-(1,3-benzodioxol-5-yloxy)propanoate.

Molecular Properties

Compound Namemethyl 2-(1,3-benzodioxol-5-yloxy)propanoate
PubChem CID4507465
Molecular FormulaC11H12O5
Molecular Weight224.21 g/mol
Exact Mass224.07
IUPAC Namemethyl 2-(1,3-benzodioxol-5-yloxy)propanoate
SMILESCOC(=O)C(C)Oc1ccc2c(c1)OCO2
InChIInChI=1S/C11H12O5/c1-7(11(12)13-2)16-8-3-4-9-10(5-8)15-6-14-9/h3-5,7H,6H2,1-2H3
InChIKeyOWWUVCPUNQXVEC-UHFFFAOYSA-N
XLogP1.36
TPSA53.99 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.21
LogP ≤ 51.36
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-(1,3-benzodioxol-5-yloxy)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(1,3-benzodioxol-5-yloxy)propanoate?
The IUPAC name of methyl 2-(1,3-benzodioxol-5-yloxy)propanoate (CID 4507465) is methyl 2-(1,3-benzodioxol-5-yloxy)propanoate.
What is the SMILES notation for methyl 2-(1,3-benzodioxol-5-yloxy)propanoate?
The canonical SMILES for methyl 2-(1,3-benzodioxol-5-yloxy)propanoate is COC(=O)C(C)Oc1ccc2c(c1)OCO2.
What is the InChIKey of methyl 2-(1,3-benzodioxol-5-yloxy)propanoate?
The InChIKey is OWWUVCPUNQXVEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O5/c1-7(11(12)13-2)16-8-3-4-9-10(5-8)15-6-14-9/h3-5,7H,6H2,1-2H3.
What are the key properties of methyl 2-(1,3-benzodioxol-5-yloxy)propanoate?
methyl 2-(1,3-benzodioxol-5-yloxy)propanoate has a molecular weight of 224.21 g/mol, XLogP of 1.36, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1,3-benzodioxol-5-yloxy)propanoate is sourced from PubChem (CID 4507465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).