C18H18O5 — CID 78766133
1,3-benzodioxol-5-ylmethyl 2-(4-methylphenoxy)propanoate (PubChem CID 78766133) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl 2-(4-methylphenoxy)propanoate.
| Compound Name | 1,3-benzodioxol-5-ylmethyl 2-(4-methylphenoxy)propanoate |
|---|---|
| PubChem CID | 78766133 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl 2-(4-methylphenoxy)propanoate |
| SMILES | Cc1ccc(OC(C)C(=O)OCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C18H18O5/c1-12-3-6-15(7-4-12)23-13(2)18(19)20-10-14-5-8-16-17(9-14)22-11-21-16/h3-9,13H,10-11H2,1-2H3 |
| InChIKey | TZZRQEVTOJSGBK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |