C19H19FO5 — CID 10521496
1,3-benzodioxol-5-ylmethyl 2-(4-fluorophenoxy)-3-methylbutanoate (PubChem CID 10521496) has the molecular formula C19H19FO5 and a molecular weight of 346.35 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl 2-(4-fluorophenoxy)-3-methylbutanoate.
| Compound Name | 1,3-benzodioxol-5-ylmethyl 2-(4-fluorophenoxy)-3-methylbutanoate |
|---|---|
| PubChem CID | 10521496 |
| Molecular Formula | C19H19FO5 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl 2-(4-fluorophenoxy)-3-methylbutanoate |
| SMILES | CC(C)C(Oc1ccc(F)cc1)C(=O)OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H19FO5/c1-12(2)18(25-15-6-4-14(20)5-7-15)19(21)22-10-13-3-8-16-17(9-13)24-11-23-16/h3-9,12,18H,10-11H2,1-2H3 |
| InChIKey | PGSSDGFODSIYTH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |