1,3-benzodioxol-5-ylmethyl 2-(4-cyanophenoxy)propanoate

C18H15NO5 — CID 42900529

IUPAC1,3-benzodioxol-5-ylmethyl 2-(4-cyanophenoxy)propanoate
SMILESCC(Oc1ccc(C#N)cc1)C(=O)OCc1ccc2c(c1)OCO2
InChIInChI=1S/C18H15NO5/c1-12(24-15-5-2-13(9-19)3-6-15)18(20)21-10-14-4-7-16-17(8-14)23-11-22-16/h2-8,12H,10-11H2,1H3
InChIKeySHJJJCIZOXYYOY-UHFFFAOYSA-N
MW325.32 g/mol
LogP2.80
Rot. Bonds5

About 1,3-benzodioxol-5-ylmethyl 2-(4-cyanophenoxy)propanoate

1,3-benzodioxol-5-ylmethyl 2-(4-cyanophenoxy)propanoate (PubChem CID 42900529) has the molecular formula C18H15NO5 and a molecular weight of 325.32 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl 2-(4-cyanophenoxy)propanoate.

Molecular Properties

Compound Name1,3-benzodioxol-5-ylmethyl 2-(4-cyanophenoxy)propanoate
PubChem CID42900529
Molecular FormulaC18H15NO5
Molecular Weight325.32 g/mol
Exact Mass325.10
IUPAC Name1,3-benzodioxol-5-ylmethyl 2-(4-cyanophenoxy)propanoate
SMILESCC(Oc1ccc(C#N)cc1)C(=O)OCc1ccc2c(c1)OCO2
InChIInChI=1S/C18H15NO5/c1-12(24-15-5-2-13(9-19)3-6-15)18(20)21-10-14-4-7-16-17(8-14)23-11-22-16/h2-8,12H,10-11H2,1H3
InChIKeySHJJJCIZOXYYOY-UHFFFAOYSA-N
XLogP2.80
TPSA77.78 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500325.32
LogP ≤ 52.80
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze 1,3-benzodioxol-5-ylmethyl 2-(4-cyanophenoxy)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-benzodioxol-5-ylmethyl 2-(4-cyanophenoxy)propanoate?
The IUPAC name of 1,3-benzodioxol-5-ylmethyl 2-(4-cyanophenoxy)propanoate (CID 42900529) is 1,3-benzodioxol-5-ylmethyl 2-(4-cyanophenoxy)propanoate.
What is the SMILES notation for 1,3-benzodioxol-5-ylmethyl 2-(4-cyanophenoxy)propanoate?
The canonical SMILES for 1,3-benzodioxol-5-ylmethyl 2-(4-cyanophenoxy)propanoate is CC(Oc1ccc(C#N)cc1)C(=O)OCc1ccc2c(c1)OCO2.
What is the InChIKey of 1,3-benzodioxol-5-ylmethyl 2-(4-cyanophenoxy)propanoate?
The InChIKey is SHJJJCIZOXYYOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO5/c1-12(24-15-5-2-13(9-19)3-6-15)18(20)21-10-14-4-7-16-17(8-14)23-11-22-16/h2-8,12H,10-11H2,1H3.
What are the key properties of 1,3-benzodioxol-5-ylmethyl 2-(4-cyanophenoxy)propanoate?
1,3-benzodioxol-5-ylmethyl 2-(4-cyanophenoxy)propanoate has a molecular weight of 325.32 g/mol, XLogP of 2.80, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzodioxol-5-ylmethyl 2-(4-cyanophenoxy)propanoate is sourced from PubChem (CID 42900529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).