C18H15NO5 — CID 42900529
1,3-benzodioxol-5-ylmethyl 2-(4-cyanophenoxy)propanoate (PubChem CID 42900529) has the molecular formula C18H15NO5 and a molecular weight of 325.32 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl 2-(4-cyanophenoxy)propanoate.
| Compound Name | 1,3-benzodioxol-5-ylmethyl 2-(4-cyanophenoxy)propanoate |
|---|---|
| PubChem CID | 42900529 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl 2-(4-cyanophenoxy)propanoate |
| SMILES | CC(Oc1ccc(C#N)cc1)C(=O)OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H15NO5/c1-12(24-15-5-2-13(9-19)3-6-15)18(20)21-10-14-4-7-16-17(8-14)23-11-22-16/h2-8,12H,10-11H2,1H3 |
| InChIKey | SHJJJCIZOXYYOY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |