C18H16N2O4 — CID 7858145
(2S)-N-(1,3-benzodioxol-5-ylmethyl)-2-(4-cyanophenoxy)propanamide (PubChem CID 7858145) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is (2S)-N-(1,3-benzodioxol-5-ylmethyl)-2-(4-cyanophenoxy)propanamide.
| Compound Name | (2S)-N-(1,3-benzodioxol-5-ylmethyl)-2-(4-cyanophenoxy)propanamide |
|---|---|
| PubChem CID | 7858145 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | (2S)-N-(1,3-benzodioxol-5-ylmethyl)-2-(4-cyanophenoxy)propanamide |
| SMILES | C[C@H](Oc1ccc(C#N)cc1)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H16N2O4/c1-12(24-15-5-2-13(9-19)3-6-15)18(21)20-10-14-4-7-16-17(8-14)23-11-22-16/h2-8,12H,10-11H2,1H3,(H,20,21)/t12-/m0/s1 |
| InChIKey | BIMCOSSXWSWJTO-LBPRGKRZSA-N |
| XLogP | 2.37 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |