C16H13FO4 — CID 43413295
2-(1,3-benzodioxol-5-yloxy)-1-(4-fluorophenyl)propan-1-one (PubChem CID 43413295) has the molecular formula C16H13FO4 and a molecular weight of 288.27 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)-1-(4-fluorophenyl)propan-1-one.
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)-1-(4-fluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 43413295 |
| Molecular Formula | C16H13FO4 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)-1-(4-fluorophenyl)propan-1-one |
| SMILES | CC(Oc1ccc2c(c1)OCO2)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H13FO4/c1-10(16(18)11-2-4-12(17)5-3-11)21-13-6-7-14-15(8-13)20-9-19-14/h2-8,10H,9H2,1H3 |
| InChIKey | MOWHTKYSIBCAGT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |