C17H15FN2O5 — CID 4682218
N'-[2-(4-fluorophenoxy)propanoyl]-1,3-benzodioxole-5-carbohydrazide (PubChem CID 4682218) has the molecular formula C17H15FN2O5 and a molecular weight of 346.31 g/mol. Its IUPAC name is N'-[2-(4-fluorophenoxy)propanoyl]-1,3-benzodioxole-5-carbohydrazide.
| Compound Name | N'-[2-(4-fluorophenoxy)propanoyl]-1,3-benzodioxole-5-carbohydrazide |
|---|---|
| PubChem CID | 4682218 |
| Molecular Formula | C17H15FN2O5 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | N'-[2-(4-fluorophenoxy)propanoyl]-1,3-benzodioxole-5-carbohydrazide |
| SMILES | CC(Oc1ccc(F)cc1)C(=O)NNC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H15FN2O5/c1-10(25-13-5-3-12(18)4-6-13)16(21)19-20-17(22)11-2-7-14-15(8-11)24-9-23-14/h2-8,10H,9H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | QIGHOONMTWBOAF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|