C11H12O4 — CID 6934005
(3S)-3-(1,3-benzodioxol-5-yloxy)butan-2-one (PubChem CID 6934005) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is (3S)-3-(1,3-benzodioxol-5-yloxy)butan-2-one.
| Compound Name | (3S)-3-(1,3-benzodioxol-5-yloxy)butan-2-one |
|---|---|
| PubChem CID | 6934005 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (3S)-3-(1,3-benzodioxol-5-yloxy)butan-2-one |
| SMILES | CC(=O)[C@H](C)Oc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H12O4/c1-7(12)8(2)15-9-3-4-10-11(5-9)14-6-13-10/h3-5,8H,6H2,1-2H3/t8-/m0/s1 |
| InChIKey | BYIVAECGUIYOLC-QMMMGPOBSA-N |
| XLogP | 1.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |