C16H21NO4 — CID 45147830
2-(1,3-benzodioxol-5-yloxy)-N-cyclohexylpropanamide (PubChem CID 45147830) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)-N-cyclohexylpropanamide.
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 45147830 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)-N-cyclohexylpropanamide |
| SMILES | CC(Oc1ccc2c(c1)OCO2)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C16H21NO4/c1-11(16(18)17-12-5-3-2-4-6-12)21-13-7-8-14-15(9-13)20-10-19-14/h7-9,11-12H,2-6,10H2,1H3,(H,17,18) |
| InChIKey | CSIYVLGFCCKQFJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |