C17H23NO3 — CID 166443374
(2S)-3-(1,3-benzodioxol-5-yl)-N-cyclohexyl-2-methylpropanamide (PubChem CID 166443374) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is (2S)-3-(1,3-benzodioxol-5-yl)-N-cyclohexyl-2-methylpropanamide.
| Compound Name | (2S)-3-(1,3-benzodioxol-5-yl)-N-cyclohexyl-2-methylpropanamide |
|---|---|
| PubChem CID | 166443374 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | (2S)-3-(1,3-benzodioxol-5-yl)-N-cyclohexyl-2-methylpropanamide |
| SMILES | C[C@@H](Cc1ccc2c(c1)OCO2)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H23NO3/c1-12(17(19)18-14-5-3-2-4-6-14)9-13-7-8-15-16(10-13)21-11-20-15/h7-8,10,12,14H,2-6,9,11H2,1H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | GRIOWELRBFBFNM-LBPRGKRZSA-N |
| XLogP | 3.04 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |