C16H21NO3S — CID 17405781
2-(1,3-benzodioxol-5-ylmethylsulfanyl)-N-cyclohexylacetamide (PubChem CID 17405781) has the molecular formula C16H21NO3S and a molecular weight of 307.41 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethylsulfanyl)-N-cyclohexylacetamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethylsulfanyl)-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 17405781 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethylsulfanyl)-N-cyclohexylacetamide |
| SMILES | O=C(CSCc1ccc2c(c1)OCO2)NC1CCCCC1 |
| InChI | InChI=1S/C16H21NO3S/c18-16(17-13-4-2-1-3-5-13)10-21-9-12-6-7-14-15(8-12)20-11-19-14/h6-8,13H,1-5,9-11H2,(H,17,18) |
| InChIKey | CQFIPMROBYMQAZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |