C14H17Cl2NOS — CID 17309803
N-cyclopentyl-2-[(3,4-dichlorophenyl)methylsulfanyl]acetamide (PubChem CID 17309803) has the molecular formula C14H17Cl2NOS and a molecular weight of 318.27 g/mol. Its IUPAC name is N-cyclopentyl-2-[(3,4-dichlorophenyl)methylsulfanyl]acetamide.
| Compound Name | N-cyclopentyl-2-[(3,4-dichlorophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 17309803 |
| Molecular Formula | C14H17Cl2NOS |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | N-cyclopentyl-2-[(3,4-dichlorophenyl)methylsulfanyl]acetamide |
| SMILES | O=C(CSCc1ccc(Cl)c(Cl)c1)NC1CCCC1 |
| InChI | InChI=1S/C14H17Cl2NOS/c15-12-6-5-10(7-13(12)16)8-19-9-14(18)17-11-3-1-2-4-11/h5-7,11H,1-4,8-9H2,(H,17,18) |
| InChIKey | KAXRXTFSZGIWCM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |