C14H17Cl2NO — CID 2557208
N-cyclohexyl-2-(3,4-dichlorophenyl)acetamide (PubChem CID 2557208) has the molecular formula C14H17Cl2NO and a molecular weight of 286.20 g/mol. Its IUPAC name is N-cyclohexyl-2-(3,4-dichlorophenyl)acetamide.
| Compound Name | N-cyclohexyl-2-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 2557208 |
| Molecular Formula | C14H17Cl2NO |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | N-cyclohexyl-2-(3,4-dichlorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)NC1CCCCC1 |
| InChI | InChI=1S/C14H17Cl2NO/c15-12-7-6-10(8-13(12)16)9-14(18)17-11-4-2-1-3-5-11/h6-8,11H,1-5,9H2,(H,17,18) |
| InChIKey | DGWUMUKYENUTSS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |