C16H19Cl2NO3 — CID 2430435
[2-(cycloheptylamino)-2-oxoethyl] 3,4-dichlorobenzoate (PubChem CID 2430435) has the molecular formula C16H19Cl2NO3 and a molecular weight of 344.24 g/mol. Its IUPAC name is [2-(cycloheptylamino)-2-oxoethyl] 3,4-dichlorobenzoate.
| Compound Name | [2-(cycloheptylamino)-2-oxoethyl] 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 2430435 |
| Molecular Formula | C16H19Cl2NO3 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | [2-(cycloheptylamino)-2-oxoethyl] 3,4-dichlorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(Cl)c(Cl)c1)NC1CCCCCC1 |
| InChI | InChI=1S/C16H19Cl2NO3/c17-13-8-7-11(9-14(13)18)16(21)22-10-15(20)19-12-5-3-1-2-4-6-12/h7-9,12H,1-6,10H2,(H,19,20) |
| InChIKey | VEUHLAIMDGNZSR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |