C19H27ClN2O5S — CID 2510844
[2-(cyclohexylamino)-2-oxoethyl] 4-chloro-3-(diethylsulfamoyl)benzoate (PubChem CID 2510844) has the molecular formula C19H27ClN2O5S and a molecular weight of 430.95 g/mol. Its IUPAC name is [2-(cyclohexylamino)-2-oxoethyl] 4-chloro-3-(diethylsulfamoyl)benzoate.
| Compound Name | [2-(cyclohexylamino)-2-oxoethyl] 4-chloro-3-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2510844 |
| Molecular Formula | C19H27ClN2O5S |
| Molecular Weight | 430.95 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | [2-(cyclohexylamino)-2-oxoethyl] 4-chloro-3-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)OCC(=O)NC2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C19H27ClN2O5S/c1-3-22(4-2)28(25,26)17-12-14(10-11-16(17)20)19(24)27-13-18(23)21-15-8-6-5-7-9-15/h10-12,15H,3-9,13H2,1-2H3,(H,21,23) |
| InChIKey | CQXIKVFFSDASLA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.95 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |