C20H28ClN3O6S — CID 16521793
[2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-chloro-5-(diethylsulfamoyl)benzoate (PubChem CID 16521793) has the molecular formula C20H28ClN3O6S and a molecular weight of 473.98 g/mol. Its IUPAC name is [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-chloro-5-(diethylsulfamoyl)benzoate.
| Compound Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-chloro-5-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 16521793 |
| Molecular Formula | C20H28ClN3O6S |
| Molecular Weight | 473.98 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-chloro-5-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(C(=O)OCC(=O)NC(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C20H28ClN3O6S/c1-3-24(4-2)31(28,29)15-10-11-17(21)16(12-15)19(26)30-13-18(25)23-20(27)22-14-8-6-5-7-9-14/h10-12,14H,3-9,13H2,1-2H3,(H2,22,23,25,27) |
| InChIKey | UNEYKDHOEIUIOK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.98 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |