C19H22ClN3O6S — CID 2642873
[2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 2-chloro-5-(diethylsulfamoyl)benzoate (PubChem CID 2642873) has the molecular formula C19H22ClN3O6S and a molecular weight of 455.92 g/mol. Its IUPAC name is [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 2-chloro-5-(diethylsulfamoyl)benzoate.
| Compound Name | [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 2-chloro-5-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2642873 |
| Molecular Formula | C19H22ClN3O6S |
| Molecular Weight | 455.92 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 2-chloro-5-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(C(=O)OCC(=O)NC(=O)c2cccn2C)c1 |
| InChI | InChI=1S/C19H22ClN3O6S/c1-4-23(5-2)30(27,28)13-8-9-15(20)14(11-13)19(26)29-12-17(24)21-18(25)16-7-6-10-22(16)3/h6-11H,4-5,12H2,1-3H3,(H,21,24,25) |
| InChIKey | ZNGOKNZQOAMSOH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.92 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |