C19H25N3O5S — CID 7284489
[2-[5-(diethylsulfamoyl)-2-methylanilino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate (PubChem CID 7284489) has the molecular formula C19H25N3O5S and a molecular weight of 407.49 g/mol. Its IUPAC name is [2-[5-(diethylsulfamoyl)-2-methylanilino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate.
| Compound Name | [2-[5-(diethylsulfamoyl)-2-methylanilino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 7284489 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | [2-[5-(diethylsulfamoyl)-2-methylanilino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C)c(NC(=O)COC(=O)c2cccn2C)c1 |
| InChI | InChI=1S/C19H25N3O5S/c1-5-22(6-2)28(25,26)15-10-9-14(3)16(12-15)20-18(23)13-27-19(24)17-8-7-11-21(17)4/h7-12H,5-6,13H2,1-4H3,(H,20,23) |
| InChIKey | XNVGJEDLZZDFKL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |